C13H12ClNS — CID 82087323
4-(3-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine (PubChem CID 82087323) has the molecular formula C13H12ClNS and a molecular weight of 249.77 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine.
| Compound Name | 4-(3-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 82087323 |
| Molecular Formula | C13H12ClNS |
| Molecular Weight | 249.77 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 4-(3-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine |
| SMILES | Clc1cccc(C2NCCc3sccc32)c1 |
| InChI | InChI=1S/C13H12ClNS/c14-10-3-1-2-9(8-10)13-11-5-7-16-12(11)4-6-15-13/h1-3,5,7-8,13,15H,4,6H2 |
| InChIKey | SGGRXQLNFXCZMO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.77 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |