C12H5F3N2O — CID 82087328
2-oxo-4-(2,3,4-trifluorophenyl)-1H-pyridine-3-carbonitrile (PubChem CID 82087328) has the molecular formula C12H5F3N2O and a molecular weight of 250.18 g/mol. Its IUPAC name is 2-oxo-4-(2,3,4-trifluorophenyl)-1H-pyridine-3-carbonitrile.
| Compound Name | 2-oxo-4-(2,3,4-trifluorophenyl)-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 82087328 |
| Molecular Formula | C12H5F3N2O |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 2-oxo-4-(2,3,4-trifluorophenyl)-1H-pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(F)c(F)c2F)cc[nH]c1=O |
| InChI | InChI=1S/C12H5F3N2O/c13-9-2-1-7(10(14)11(9)15)6-3-4-17-12(18)8(6)5-16/h1-4H,(H,17,18) |
| InChIKey | CNFUXCYWVGHMTP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|