About 2-oxo-4-(2,3,4-trifluorophenyl)-1H-pyridine-3-carbonitrile
2-oxo-4-(2,3,4-trifluorophenyl)-1H-pyridine-3-carbonitrile (PubChem CID 82087328) has the molecular formula C12H5F3N2O
and a molecular weight of 250.18 g/mol. Its IUPAC name is 2-oxo-4-(2,3,4-trifluorophenyl)-1H-pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-oxo-4-(2,3,4-trifluorophenyl)-1H-pyridine-3-carbonitrile |
| PubChem CID | 82087328 |
| Molecular Formula | C12H5F3N2O |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 2-oxo-4-(2,3,4-trifluorophenyl)-1H-pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(F)c(F)c2F)cc[nH]c1=O |
| InChI | InChI=1S/C12H5F3N2O/c13-9-2-1-7(10(14)11(9)15)6-3-4-17-12(18)8(6)5-16/h1-4H,(H,17,18) |
| InChIKey | CNFUXCYWVGHMTP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-4-(2,3,4-trifluorophenyl)-1H-pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-4-(2,3,4-trifluorophenyl)-1H-pyridine-3-carbonitrile?
The IUPAC name of 2-oxo-4-(2,3,4-trifluorophenyl)-1H-pyridine-3-carbonitrile (CID 82087328) is 2-oxo-4-(2,3,4-trifluorophenyl)-1H-pyridine-3-carbonitrile.
What is the SMILES notation for 2-oxo-4-(2,3,4-trifluorophenyl)-1H-pyridine-3-carbonitrile?
The canonical SMILES for 2-oxo-4-(2,3,4-trifluorophenyl)-1H-pyridine-3-carbonitrile is N#Cc1c(-c2ccc(F)c(F)c2F)cc[nH]c1=O.
What is the InChIKey of 2-oxo-4-(2,3,4-trifluorophenyl)-1H-pyridine-3-carbonitrile?
The InChIKey is CNFUXCYWVGHMTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5F3N2O/c13-9-2-1-7(10(14)11(9)15)6-3-4-17-12(18)8(6)5-16/h1-4H,(H,17,18).
What are the key properties of 2-oxo-4-(2,3,4-trifluorophenyl)-1H-pyridine-3-carbonitrile?
2-oxo-4-(2,3,4-trifluorophenyl)-1H-pyridine-3-carbonitrile has a molecular weight of 250.18 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-4-(2,3,4-trifluorophenyl)-1H-pyridine-3-carbonitrile is sourced from PubChem (CID 82087328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).