C11H10FN3OS — CID 82087611
4-amino-6-(3-fluoro-4-methoxyphenyl)-1H-pyrimidine-2-thione (PubChem CID 82087611) has the molecular formula C11H10FN3OS and a molecular weight of 251.29 g/mol. Its IUPAC name is 4-amino-6-(3-fluoro-4-methoxyphenyl)-1H-pyrimidine-2-thione.
| Compound Name | 4-amino-6-(3-fluoro-4-methoxyphenyl)-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 82087611 |
| Molecular Formula | C11H10FN3OS |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 4-amino-6-(3-fluoro-4-methoxyphenyl)-1H-pyrimidine-2-thione |
| SMILES | COc1ccc(-c2cc(N)nc(=S)[nH]2)cc1F |
| InChI | InChI=1S/C11H10FN3OS/c1-16-9-3-2-6(4-7(9)12)8-5-10(13)15-11(17)14-8/h2-5H,1H3,(H3,13,14,15,17) |
| InChIKey | RVHFECHEXIAXOX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|