About 5-(2,4-dimethylphenyl)-3-methyl-1,3-dihydroindol-2-one
5-(2,4-dimethylphenyl)-3-methyl-1,3-dihydroindol-2-one (PubChem CID 82087696) has the molecular formula C17H17NO
and a molecular weight of 251.33 g/mol. Its IUPAC name is 5-(2,4-dimethylphenyl)-3-methyl-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 5-(2,4-dimethylphenyl)-3-methyl-1,3-dihydroindol-2-one |
| PubChem CID | 82087696 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 5-(2,4-dimethylphenyl)-3-methyl-1,3-dihydroindol-2-one |
| SMILES | Cc1ccc(-c2ccc3c(c2)C(C)C(=O)N3)c(C)c1 |
| InChI | InChI=1S/C17H17NO/c1-10-4-6-14(11(2)8-10)13-5-7-16-15(9-13)12(3)17(19)18-16/h4-9,12H,1-3H3,(H,18,19) |
| InChIKey | LCLBLRFDHYOCAH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(2,4-dimethylphenyl)-3-methyl-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-dimethylphenyl)-3-methyl-1,3-dihydroindol-2-one?
The IUPAC name of 5-(2,4-dimethylphenyl)-3-methyl-1,3-dihydroindol-2-one (CID 82087696) is 5-(2,4-dimethylphenyl)-3-methyl-1,3-dihydroindol-2-one.
What is the SMILES notation for 5-(2,4-dimethylphenyl)-3-methyl-1,3-dihydroindol-2-one?
The canonical SMILES for 5-(2,4-dimethylphenyl)-3-methyl-1,3-dihydroindol-2-one is Cc1ccc(-c2ccc3c(c2)C(C)C(=O)N3)c(C)c1.
What is the InChIKey of 5-(2,4-dimethylphenyl)-3-methyl-1,3-dihydroindol-2-one?
The InChIKey is LCLBLRFDHYOCAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO/c1-10-4-6-14(11(2)8-10)13-5-7-16-15(9-13)12(3)17(19)18-16/h4-9,12H,1-3H3,(H,18,19).
What are the key properties of 5-(2,4-dimethylphenyl)-3-methyl-1,3-dihydroindol-2-one?
5-(2,4-dimethylphenyl)-3-methyl-1,3-dihydroindol-2-one has a molecular weight of 251.33 g/mol, XLogP of 4.03, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-dimethylphenyl)-3-methyl-1,3-dihydroindol-2-one is sourced from PubChem (CID 82087696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).