C11H13NO4S — CID 82088679
2-(2-ethoxyphenyl)-1,1-dioxo-1,2-thiazolidin-3-one (PubChem CID 82088679) has the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. Its IUPAC name is 2-(2-ethoxyphenyl)-1,1-dioxo-1,2-thiazolidin-3-one.
| Compound Name | 2-(2-ethoxyphenyl)-1,1-dioxo-1,2-thiazolidin-3-one |
|---|---|
| PubChem CID | 82088679 |
| Molecular Formula | C11H13NO4S |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 2-(2-ethoxyphenyl)-1,1-dioxo-1,2-thiazolidin-3-one |
| SMILES | CCOc1ccccc1N1C(=O)CCS1(=O)=O |
| InChI | InChI=1S/C11H13NO4S/c1-2-16-10-6-4-3-5-9(10)12-11(13)7-8-17(12,14)15/h3-6H,2,7-8H2,1H3 |
| InChIKey | ZOUWBUKRRCOAMH-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |