C14H11ClN2O — CID 82089655
2-chloro-4-(furan-2-yl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 82089655) has the molecular formula C14H11ClN2O and a molecular weight of 258.71 g/mol. Its IUPAC name is 2-chloro-4-(furan-2-yl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-chloro-4-(furan-2-yl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 82089655 |
| Molecular Formula | C14H11ClN2O |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-chloro-4-(furan-2-yl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | N#Cc1c(Cl)nc2c(c1-c1ccco1)CCCC2 |
| InChI | InChI=1S/C14H11ClN2O/c15-14-10(8-16)13(12-6-3-7-18-12)9-4-1-2-5-11(9)17-14/h3,6-7H,1-2,4-5H2 |
| InChIKey | CXLCVKFJQTYSEI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|