C12H16Cl2N2 — CID 82089741
3,4-dichloro-N-(2-pyrrolidin-1-ylethyl)aniline (PubChem CID 82089741) has the molecular formula C12H16Cl2N2 and a molecular weight of 259.18 g/mol. Its IUPAC name is 3,4-dichloro-N-(2-pyrrolidin-1-ylethyl)aniline.
| Compound Name | 3,4-dichloro-N-(2-pyrrolidin-1-ylethyl)aniline |
|---|---|
| PubChem CID | 82089741 |
| Molecular Formula | C12H16Cl2N2 |
| Molecular Weight | 259.18 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 3,4-dichloro-N-(2-pyrrolidin-1-ylethyl)aniline |
| SMILES | Clc1ccc(NCCN2CCCC2)cc1Cl |
| InChI | InChI=1S/C12H16Cl2N2/c13-11-4-3-10(9-12(11)14)15-5-8-16-6-1-2-7-16/h3-4,9,15H,1-2,5-8H2 |
| InChIKey | DZEIZVBZBPQIFW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.18 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |