About 4-methyl-1,1-dioxo-2-(4-propan-2-ylphenyl)-1,2-thiazolidin-3-one
4-methyl-1,1-dioxo-2-(4-propan-2-ylphenyl)-1,2-thiazolidin-3-one (PubChem CID 82092283) has the molecular formula C13H17NO3S
and a molecular weight of 267.35 g/mol. Its IUPAC name is 4-methyl-1,1-dioxo-2-(4-propan-2-ylphenyl)-1,2-thiazolidin-3-one.
Molecular Properties
| Compound Name | 4-methyl-1,1-dioxo-2-(4-propan-2-ylphenyl)-1,2-thiazolidin-3-one |
| PubChem CID | 82092283 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 4-methyl-1,1-dioxo-2-(4-propan-2-ylphenyl)-1,2-thiazolidin-3-one |
| SMILES | CC1CS(=O)(=O)N(c2ccc(C(C)C)cc2)C1=O |
| InChI | InChI=1S/C13H17NO3S/c1-9(2)11-4-6-12(7-5-11)14-13(15)10(3)8-18(14,16)17/h4-7,9-10H,8H2,1-3H3 |
| InChIKey | SUZFCEUEFPFKHB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-1,1-dioxo-2-(4-propan-2-ylphenyl)-1,2-thiazolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,1-dioxo-2-(4-propan-2-ylphenyl)-1,2-thiazolidin-3-one?
The IUPAC name of 4-methyl-1,1-dioxo-2-(4-propan-2-ylphenyl)-1,2-thiazolidin-3-one (CID 82092283) is 4-methyl-1,1-dioxo-2-(4-propan-2-ylphenyl)-1,2-thiazolidin-3-one.
What is the SMILES notation for 4-methyl-1,1-dioxo-2-(4-propan-2-ylphenyl)-1,2-thiazolidin-3-one?
The canonical SMILES for 4-methyl-1,1-dioxo-2-(4-propan-2-ylphenyl)-1,2-thiazolidin-3-one is CC1CS(=O)(=O)N(c2ccc(C(C)C)cc2)C1=O.
What is the InChIKey of 4-methyl-1,1-dioxo-2-(4-propan-2-ylphenyl)-1,2-thiazolidin-3-one?
The InChIKey is SUZFCEUEFPFKHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3S/c1-9(2)11-4-6-12(7-5-11)14-13(15)10(3)8-18(14,16)17/h4-7,9-10H,8H2,1-3H3.
What are the key properties of 4-methyl-1,1-dioxo-2-(4-propan-2-ylphenyl)-1,2-thiazolidin-3-one?
4-methyl-1,1-dioxo-2-(4-propan-2-ylphenyl)-1,2-thiazolidin-3-one has a molecular weight of 267.35 g/mol, XLogP of 2.12, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,1-dioxo-2-(4-propan-2-ylphenyl)-1,2-thiazolidin-3-one is sourced from PubChem (CID 82092283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).