C15H12ClN3 — CID 82093014
2-chloro-4-pyridin-3-yl-5,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 82093014) has the molecular formula C15H12ClN3 and a molecular weight of 269.73 g/mol. Its IUPAC name is 2-chloro-4-pyridin-3-yl-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-chloro-4-pyridin-3-yl-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 82093014 |
| Molecular Formula | C15H12ClN3 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 2-chloro-4-pyridin-3-yl-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | N#Cc1c(Cl)nc2c(c1-c1cccnc1)CCCC2 |
| InChI | InChI=1S/C15H12ClN3/c16-15-12(8-17)14(10-4-3-7-18-9-10)11-5-1-2-6-13(11)19-15/h3-4,7,9H,1-2,5-6H2 |
| InChIKey | JYRPSSHLWQDHPL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|