C12H16BrNO — CID 82093055
2-(3-bromo-4-methoxyphenyl)-2-cyclopropylethanamine (PubChem CID 82093055) has the molecular formula C12H16BrNO and a molecular weight of 270.17 g/mol. Its IUPAC name is 2-(3-bromo-4-methoxyphenyl)-2-cyclopropylethanamine.
| Compound Name | 2-(3-bromo-4-methoxyphenyl)-2-cyclopropylethanamine |
|---|---|
| PubChem CID | 82093055 |
| Molecular Formula | C12H16BrNO |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 2-(3-bromo-4-methoxyphenyl)-2-cyclopropylethanamine |
| SMILES | COc1ccc(C(CN)C2CC2)cc1Br |
| InChI | InChI=1S/C12H16BrNO/c1-15-12-5-4-9(6-11(12)13)10(7-14)8-2-3-8/h4-6,8,10H,2-3,7,14H2,1H3 |
| InChIKey | FUHQELZOECMIFK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |