About 2-phenyl-1H-imidazole-4,5-dicarbonitrile
2-phenyl-1H-imidazole-4,5-dicarbonitrile (PubChem CID 820939) has the molecular formula C11H6N4
and a molecular weight of 194.20 g/mol. Its IUPAC name is 2-phenyl-1H-imidazole-4,5-dicarbonitrile.
Molecular Properties
| Compound Name | 2-phenyl-1H-imidazole-4,5-dicarbonitrile |
| PubChem CID | 820939 |
| Molecular Formula | C11H6N4 |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 2-phenyl-1H-imidazole-4,5-dicarbonitrile |
| SMILES | N#Cc1nc(-c2ccccc2)[nH]c1C#N |
| InChI | InChI=1S/C11H6N4/c12-6-9-10(7-13)15-11(14-9)8-4-2-1-3-5-8/h1-5H,(H,14,15) |
| InChIKey | PGSHQANDAMACEF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenyl-1H-imidazole-4,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-1H-imidazole-4,5-dicarbonitrile?
The IUPAC name of 2-phenyl-1H-imidazole-4,5-dicarbonitrile (CID 820939) is 2-phenyl-1H-imidazole-4,5-dicarbonitrile.
What is the SMILES notation for 2-phenyl-1H-imidazole-4,5-dicarbonitrile?
The canonical SMILES for 2-phenyl-1H-imidazole-4,5-dicarbonitrile is N#Cc1nc(-c2ccccc2)[nH]c1C#N.
What is the InChIKey of 2-phenyl-1H-imidazole-4,5-dicarbonitrile?
The InChIKey is PGSHQANDAMACEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6N4/c12-6-9-10(7-13)15-11(14-9)8-4-2-1-3-5-8/h1-5H,(H,14,15).
What are the key properties of 2-phenyl-1H-imidazole-4,5-dicarbonitrile?
2-phenyl-1H-imidazole-4,5-dicarbonitrile has a molecular weight of 194.20 g/mol, XLogP of 1.82, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-1H-imidazole-4,5-dicarbonitrile is sourced from PubChem (CID 820939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).