C11H9Cl2NO3 — CID 82098501
5-(2,4-dichlorophenyl)-5-ethyl-1,3-oxazolidine-2,4-dione (PubChem CID 82098501) has the molecular formula C11H9Cl2NO3 and a molecular weight of 274.10 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-5-ethyl-1,3-oxazolidine-2,4-dione.
| Compound Name | 5-(2,4-dichlorophenyl)-5-ethyl-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 82098501 |
| Molecular Formula | C11H9Cl2NO3 |
| Molecular Weight | 274.10 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-5-ethyl-1,3-oxazolidine-2,4-dione |
| SMILES | CCC1(c2ccc(Cl)cc2Cl)OC(=O)NC1=O |
| InChI | InChI=1S/C11H9Cl2NO3/c1-2-11(9(15)14-10(16)17-11)7-4-3-6(12)5-8(7)13/h3-5H,2H2,1H3,(H,14,15,16) |
| InChIKey | MZGVXRVXPQVHQZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.10 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |