C14H15Cl2N3O2 — CID 82098563
8-[(3,4-dichlorophenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 82098563) has the molecular formula C14H15Cl2N3O2 and a molecular weight of 328.20 g/mol. Its IUPAC name is 8-[(3,4-dichlorophenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[(3,4-dichlorophenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 82098563 |
| Molecular Formula | C14H15Cl2N3O2 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 8-[(3,4-dichlorophenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCN(Cc3ccc(Cl)c(Cl)c3)CC2)N1 |
| InChI | InChI=1S/C14H15Cl2N3O2/c15-10-2-1-9(7-11(10)16)8-19-5-3-14(4-6-19)12(20)17-13(21)18-14/h1-2,7H,3-6,8H2,(H2,17,18,20,21) |
| InChIKey | CEXQBPIXKYZJPB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|