C13H22N4O3 — CID 82098595
8-(2-morpholin-4-ylethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 82098595) has the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 8-(2-morpholin-4-ylethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(2-morpholin-4-ylethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 82098595 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 8-(2-morpholin-4-ylethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCN(CCN3CCOCC3)CC2)N1 |
| InChI | InChI=1S/C13H22N4O3/c18-11-13(15-12(19)14-11)1-3-16(4-2-13)5-6-17-7-9-20-10-8-17/h1-10H2,(H2,14,15,18,19) |
| InChIKey | HUUVDXMBJIONAD-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|