C17H16N2O — CID 82099080
6-(3,4-dimethylphenyl)-2-oxo-1-prop-2-enylpyridine-3-carbonitrile (PubChem CID 82099080) has the molecular formula C17H16N2O and a molecular weight of 264.33 g/mol. Its IUPAC name is 6-(3,4-dimethylphenyl)-2-oxo-1-prop-2-enylpyridine-3-carbonitrile.
| Compound Name | 6-(3,4-dimethylphenyl)-2-oxo-1-prop-2-enylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 82099080 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 6-(3,4-dimethylphenyl)-2-oxo-1-prop-2-enylpyridine-3-carbonitrile |
| SMILES | C=CCn1c(-c2ccc(C)c(C)c2)ccc(C#N)c1=O |
| InChI | InChI=1S/C17H16N2O/c1-4-9-19-16(8-7-15(11-18)17(19)20)14-6-5-12(2)13(3)10-14/h4-8,10H,1,9H2,2-3H3 |
| InChIKey | GTBLXJATNFVJHS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|