C15H19ClN2S — CID 82102720
N-[2-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]ethyl]propan-1-amine (PubChem CID 82102720) has the molecular formula C15H19ClN2S and a molecular weight of 294.85 g/mol. Its IUPAC name is N-[2-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]ethyl]propan-1-amine.
| Compound Name | N-[2-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 82102720 |
| Molecular Formula | C15H19ClN2S |
| Molecular Weight | 294.85 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | N-[2-[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]ethyl]propan-1-amine |
| SMILES | CCCNCCc1nc(-c2ccc(Cl)cc2)c(C)s1 |
| InChI | InChI=1S/C15H19ClN2S/c1-3-9-17-10-8-14-18-15(11(2)19-14)12-4-6-13(16)7-5-12/h4-7,17H,3,8-10H2,1-2H3 |
| InChIKey | IWCUMUKCJVQGHY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.85 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|