About (5-methylimidazo[1,2-a]pyridin-2-yl)methanol
(5-methylimidazo[1,2-a]pyridin-2-yl)methanol (PubChem CID 821038) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is (5-methylimidazo[1,2-a]pyridin-2-yl)methanol.
Molecular Properties
| Compound Name | (5-methylimidazo[1,2-a]pyridin-2-yl)methanol |
| PubChem CID | 821038 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | (5-methylimidazo[1,2-a]pyridin-2-yl)methanol |
| SMILES | Cc1cccc2nc(CO)cn12 |
| InChI | InChI=1S/C9H10N2O/c1-7-3-2-4-9-10-8(6-12)5-11(7)9/h2-5,12H,6H2,1H3 |
| InChIKey | BIUQSIPXUVGMHC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-methylimidazo[1,2-a]pyridin-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methylimidazo[1,2-a]pyridin-2-yl)methanol?
The IUPAC name of (5-methylimidazo[1,2-a]pyridin-2-yl)methanol (CID 821038) is (5-methylimidazo[1,2-a]pyridin-2-yl)methanol.
What is the SMILES notation for (5-methylimidazo[1,2-a]pyridin-2-yl)methanol?
The canonical SMILES for (5-methylimidazo[1,2-a]pyridin-2-yl)methanol is Cc1cccc2nc(CO)cn12.
What is the InChIKey of (5-methylimidazo[1,2-a]pyridin-2-yl)methanol?
The InChIKey is BIUQSIPXUVGMHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O/c1-7-3-2-4-9-10-8(6-12)5-11(7)9/h2-5,12H,6H2,1H3.
What are the key properties of (5-methylimidazo[1,2-a]pyridin-2-yl)methanol?
(5-methylimidazo[1,2-a]pyridin-2-yl)methanol has a molecular weight of 162.19 g/mol, XLogP of 1.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methylimidazo[1,2-a]pyridin-2-yl)methanol is sourced from PubChem (CID 821038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).