About 7-(2-amino-1,3-thiazol-4-yl)-5-ethyl-3-methyl-1,3-dihydroindol-2-one
7-(2-amino-1,3-thiazol-4-yl)-5-ethyl-3-methyl-1,3-dihydroindol-2-one (PubChem CID 82104894) has the molecular formula C14H15N3OS
and a molecular weight of 273.36 g/mol. Its IUPAC name is 7-(2-amino-1,3-thiazol-4-yl)-5-ethyl-3-methyl-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 7-(2-amino-1,3-thiazol-4-yl)-5-ethyl-3-methyl-1,3-dihydroindol-2-one |
| PubChem CID | 82104894 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 7-(2-amino-1,3-thiazol-4-yl)-5-ethyl-3-methyl-1,3-dihydroindol-2-one |
| SMILES | CCc1cc(-c2csc(N)n2)c2c(c1)C(C)C(=O)N2 |
| InChI | InChI=1S/C14H15N3OS/c1-3-8-4-9-7(2)13(18)17-12(9)10(5-8)11-6-19-14(15)16-11/h4-7H,3H2,1-2H3,(H2,15,16)(H,17,18) |
| InChIKey | IXLLRBQEOGATBI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(2-amino-1,3-thiazol-4-yl)-5-ethyl-3-methyl-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-amino-1,3-thiazol-4-yl)-5-ethyl-3-methyl-1,3-dihydroindol-2-one?
The IUPAC name of 7-(2-amino-1,3-thiazol-4-yl)-5-ethyl-3-methyl-1,3-dihydroindol-2-one (CID 82104894) is 7-(2-amino-1,3-thiazol-4-yl)-5-ethyl-3-methyl-1,3-dihydroindol-2-one.
What is the SMILES notation for 7-(2-amino-1,3-thiazol-4-yl)-5-ethyl-3-methyl-1,3-dihydroindol-2-one?
The canonical SMILES for 7-(2-amino-1,3-thiazol-4-yl)-5-ethyl-3-methyl-1,3-dihydroindol-2-one is CCc1cc(-c2csc(N)n2)c2c(c1)C(C)C(=O)N2.
What is the InChIKey of 7-(2-amino-1,3-thiazol-4-yl)-5-ethyl-3-methyl-1,3-dihydroindol-2-one?
The InChIKey is IXLLRBQEOGATBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3OS/c1-3-8-4-9-7(2)13(18)17-12(9)10(5-8)11-6-19-14(15)16-11/h4-7H,3H2,1-2H3,(H2,15,16)(H,17,18).
What are the key properties of 7-(2-amino-1,3-thiazol-4-yl)-5-ethyl-3-methyl-1,3-dihydroindol-2-one?
7-(2-amino-1,3-thiazol-4-yl)-5-ethyl-3-methyl-1,3-dihydroindol-2-one has a molecular weight of 273.36 g/mol, XLogP of 3.01, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-amino-1,3-thiazol-4-yl)-5-ethyl-3-methyl-1,3-dihydroindol-2-one is sourced from PubChem (CID 82104894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).