C11H17N3O — CID 82105214
2,6-dimethyl-3-piperidin-4-ylpyrimidin-4-one (PubChem CID 82105214) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 2,6-dimethyl-3-piperidin-4-ylpyrimidin-4-one.
| Compound Name | 2,6-dimethyl-3-piperidin-4-ylpyrimidin-4-one |
|---|---|
| PubChem CID | 82105214 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 2,6-dimethyl-3-piperidin-4-ylpyrimidin-4-one |
| SMILES | Cc1cc(=O)n(C2CCNCC2)c(C)n1 |
| InChI | InChI=1S/C11H17N3O/c1-8-7-11(15)14(9(2)13-8)10-3-5-12-6-4-10/h7,10,12H,3-6H2,1-2H3 |
| InChIKey | NRBIZIZCLGJHCL-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |