About 3-(3-aminopropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one
3-(3-aminopropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one (PubChem CID 82105228) has the molecular formula C10H15N3O
and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-(3-aminopropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-(3-aminopropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one |
| PubChem CID | 82105228 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 3-(3-aminopropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one |
| SMILES | NCCCn1cnc2c(c1=O)CCC2 |
| InChI | InChI=1S/C10H15N3O/c11-5-2-6-13-7-12-9-4-1-3-8(9)10(13)14/h7H,1-6,11H2 |
| InChIKey | JZGWNPKIJXFRSX-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3-aminopropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-aminopropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one?
The IUPAC name of 3-(3-aminopropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one (CID 82105228) is 3-(3-aminopropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one.
What is the SMILES notation for 3-(3-aminopropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one?
The canonical SMILES for 3-(3-aminopropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one is NCCCn1cnc2c(c1=O)CCC2.
What is the InChIKey of 3-(3-aminopropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one?
The InChIKey is JZGWNPKIJXFRSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O/c11-5-2-6-13-7-12-9-4-1-3-8(9)10(13)14/h7H,1-6,11H2.
What are the key properties of 3-(3-aminopropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one?
3-(3-aminopropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one has a molecular weight of 193.25 g/mol, XLogP of 0.08, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-aminopropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-one is sourced from PubChem (CID 82105228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).