About 3-pyrrolidin-3-yl-5,6,7,8-tetrahydroquinazolin-4-one
3-pyrrolidin-3-yl-5,6,7,8-tetrahydroquinazolin-4-one (PubChem CID 82105277) has the molecular formula C12H17N3O
and a molecular weight of 219.29 g/mol. Its IUPAC name is 3-pyrrolidin-3-yl-5,6,7,8-tetrahydroquinazolin-4-one.
Molecular Properties
| Compound Name | 3-pyrrolidin-3-yl-5,6,7,8-tetrahydroquinazolin-4-one |
| PubChem CID | 82105277 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 3-pyrrolidin-3-yl-5,6,7,8-tetrahydroquinazolin-4-one |
| SMILES | O=c1c2c(ncn1C1CCNC1)CCCC2 |
| InChI | InChI=1S/C12H17N3O/c16-12-10-3-1-2-4-11(10)14-8-15(12)9-5-6-13-7-9/h8-9,13H,1-7H2 |
| InChIKey | GKGHVWXRSAKLFO-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-pyrrolidin-3-yl-5,6,7,8-tetrahydroquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrrolidin-3-yl-5,6,7,8-tetrahydroquinazolin-4-one?
The IUPAC name of 3-pyrrolidin-3-yl-5,6,7,8-tetrahydroquinazolin-4-one (CID 82105277) is 3-pyrrolidin-3-yl-5,6,7,8-tetrahydroquinazolin-4-one.
What is the SMILES notation for 3-pyrrolidin-3-yl-5,6,7,8-tetrahydroquinazolin-4-one?
The canonical SMILES for 3-pyrrolidin-3-yl-5,6,7,8-tetrahydroquinazolin-4-one is O=c1c2c(ncn1C1CCNC1)CCCC2.
What is the InChIKey of 3-pyrrolidin-3-yl-5,6,7,8-tetrahydroquinazolin-4-one?
The InChIKey is GKGHVWXRSAKLFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O/c16-12-10-3-1-2-4-11(10)14-8-15(12)9-5-6-13-7-9/h8-9,13H,1-7H2.
What are the key properties of 3-pyrrolidin-3-yl-5,6,7,8-tetrahydroquinazolin-4-one?
3-pyrrolidin-3-yl-5,6,7,8-tetrahydroquinazolin-4-one has a molecular weight of 219.29 g/mol, XLogP of 0.66, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrrolidin-3-yl-5,6,7,8-tetrahydroquinazolin-4-one is sourced from PubChem (CID 82105277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).