C18H23N3O — CID 82105302
6-(3,4-dimethylphenyl)-2-(piperidin-4-ylmethyl)pyridazin-3-one (PubChem CID 82105302) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is 6-(3,4-dimethylphenyl)-2-(piperidin-4-ylmethyl)pyridazin-3-one.
| Compound Name | 6-(3,4-dimethylphenyl)-2-(piperidin-4-ylmethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 82105302 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 6-(3,4-dimethylphenyl)-2-(piperidin-4-ylmethyl)pyridazin-3-one |
| SMILES | Cc1ccc(-c2ccc(=O)n(CC3CCNCC3)n2)cc1C |
| InChI | InChI=1S/C18H23N3O/c1-13-3-4-16(11-14(13)2)17-5-6-18(22)21(20-17)12-15-7-9-19-10-8-15/h3-6,11,15,19H,7-10,12H2,1-2H3 |
| InChIKey | QDDLZDGJZPZUQQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |