About N',N'-dipropyl-2-quinolin-3-ylpropane-1,3-diamine
N',N'-dipropyl-2-quinolin-3-ylpropane-1,3-diamine (PubChem CID 82107801) has the molecular formula C18H27N3
and a molecular weight of 285.44 g/mol. Its IUPAC name is N',N'-dipropyl-2-quinolin-3-ylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N',N'-dipropyl-2-quinolin-3-ylpropane-1,3-diamine |
| PubChem CID | 82107801 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | N',N'-dipropyl-2-quinolin-3-ylpropane-1,3-diamine |
| SMILES | CCCN(CCC)CC(CN)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C18H27N3/c1-3-9-21(10-4-2)14-17(12-19)16-11-15-7-5-6-8-18(15)20-13-16/h5-8,11,13,17H,3-4,9-10,12,14,19H2,1-2H3 |
| InChIKey | KDAMKXGETPGZEI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N',N'-dipropyl-2-quinolin-3-ylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-dipropyl-2-quinolin-3-ylpropane-1,3-diamine?
The IUPAC name of N',N'-dipropyl-2-quinolin-3-ylpropane-1,3-diamine (CID 82107801) is N',N'-dipropyl-2-quinolin-3-ylpropane-1,3-diamine.
What is the SMILES notation for N',N'-dipropyl-2-quinolin-3-ylpropane-1,3-diamine?
The canonical SMILES for N',N'-dipropyl-2-quinolin-3-ylpropane-1,3-diamine is CCCN(CCC)CC(CN)c1cnc2ccccc2c1.
What is the InChIKey of N',N'-dipropyl-2-quinolin-3-ylpropane-1,3-diamine?
The InChIKey is KDAMKXGETPGZEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3/c1-3-9-21(10-4-2)14-17(12-19)16-11-15-7-5-6-8-18(15)20-13-16/h5-8,11,13,17H,3-4,9-10,12,14,19H2,1-2H3.
What are the key properties of N',N'-dipropyl-2-quinolin-3-ylpropane-1,3-diamine?
N',N'-dipropyl-2-quinolin-3-ylpropane-1,3-diamine has a molecular weight of 285.44 g/mol, XLogP of 3.40, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-dipropyl-2-quinolin-3-ylpropane-1,3-diamine is sourced from PubChem (CID 82107801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).