C18H18N4O2 — CID 82108418
2-(2-hydrazinylquinolin-8-yl)oxy-N-(2-methylphenyl)acetamide (PubChem CID 82108418) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 2-(2-hydrazinylquinolin-8-yl)oxy-N-(2-methylphenyl)acetamide.
| Compound Name | 2-(2-hydrazinylquinolin-8-yl)oxy-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 82108418 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-(2-hydrazinylquinolin-8-yl)oxy-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)COc1cccc2ccc(NN)nc12 |
| InChI | InChI=1S/C18H18N4O2/c1-12-5-2-3-7-14(12)20-17(23)11-24-15-8-4-6-13-9-10-16(22-19)21-18(13)15/h2-10H,11,19H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | CJKBGWUIZLAWPW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|