About 3-chloro-N-[2-[2-hydroxyethyl(methyl)amino]-2-methylpropyl]-2,2-dimethylpropanamide
3-chloro-N-[2-[2-hydroxyethyl(methyl)amino]-2-methylpropyl]-2,2-dimethylpropanamide (PubChem CID 82108610) has the molecular formula C12H25ClN2O2
and a molecular weight of 264.80 g/mol. Its IUPAC name is 3-chloro-N-[2-[2-hydroxyethyl(methyl)amino]-2-methylpropyl]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-chloro-N-[2-[2-hydroxyethyl(methyl)amino]-2-methylpropyl]-2,2-dimethylpropanamide |
| PubChem CID | 82108610 |
| Molecular Formula | C12H25ClN2O2 |
| Molecular Weight | 264.80 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 3-chloro-N-[2-[2-hydroxyethyl(methyl)amino]-2-methylpropyl]-2,2-dimethylpropanamide |
| SMILES | CN(CCO)C(C)(C)CNC(=O)C(C)(C)CCl |
| InChI | InChI=1S/C12H25ClN2O2/c1-11(2,8-13)10(17)14-9-12(3,4)15(5)6-7-16/h16H,6-9H2,1-5H3,(H,14,17) |
| InChIKey | WLCKFBXOUJPPMN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.80 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N-[2-[2-hydroxyethyl(methyl)amino]-2-methylpropyl]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[2-[2-hydroxyethyl(methyl)amino]-2-methylpropyl]-2,2-dimethylpropanamide?
The IUPAC name of 3-chloro-N-[2-[2-hydroxyethyl(methyl)amino]-2-methylpropyl]-2,2-dimethylpropanamide (CID 82108610) is 3-chloro-N-[2-[2-hydroxyethyl(methyl)amino]-2-methylpropyl]-2,2-dimethylpropanamide.
What is the SMILES notation for 3-chloro-N-[2-[2-hydroxyethyl(methyl)amino]-2-methylpropyl]-2,2-dimethylpropanamide?
The canonical SMILES for 3-chloro-N-[2-[2-hydroxyethyl(methyl)amino]-2-methylpropyl]-2,2-dimethylpropanamide is CN(CCO)C(C)(C)CNC(=O)C(C)(C)CCl.
What is the InChIKey of 3-chloro-N-[2-[2-hydroxyethyl(methyl)amino]-2-methylpropyl]-2,2-dimethylpropanamide?
The InChIKey is WLCKFBXOUJPPMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25ClN2O2/c1-11(2,8-13)10(17)14-9-12(3,4)15(5)6-7-16/h16H,6-9H2,1-5H3,(H,14,17).
What are the key properties of 3-chloro-N-[2-[2-hydroxyethyl(methyl)amino]-2-methylpropyl]-2,2-dimethylpropanamide?
3-chloro-N-[2-[2-hydroxyethyl(methyl)amino]-2-methylpropyl]-2,2-dimethylpropanamide has a molecular weight of 264.80 g/mol, XLogP of 1.07, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[2-[2-hydroxyethyl(methyl)amino]-2-methylpropyl]-2,2-dimethylpropanamide is sourced from PubChem (CID 82108610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).