About 2-chloro-N-(5-ethyl-1,3,4-oxadiazol-2-yl)propanamide
2-chloro-N-(5-ethyl-1,3,4-oxadiazol-2-yl)propanamide (PubChem CID 82109675) has the molecular formula C7H10ClN3O2
and a molecular weight of 203.63 g/mol. Its IUPAC name is 2-chloro-N-(5-ethyl-1,3,4-oxadiazol-2-yl)propanamide.
Molecular Properties
| Compound Name | 2-chloro-N-(5-ethyl-1,3,4-oxadiazol-2-yl)propanamide |
| PubChem CID | 82109675 |
| Molecular Formula | C7H10ClN3O2 |
| Molecular Weight | 203.63 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 2-chloro-N-(5-ethyl-1,3,4-oxadiazol-2-yl)propanamide |
| SMILES | CCc1nnc(NC(=O)C(C)Cl)o1 |
| InChI | InChI=1S/C7H10ClN3O2/c1-3-5-10-11-7(13-5)9-6(12)4(2)8/h4H,3H2,1-2H3,(H,9,11,12) |
| InChIKey | BQQKRIHXTCZITL-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.63 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-(5-ethyl-1,3,4-oxadiazol-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(5-ethyl-1,3,4-oxadiazol-2-yl)propanamide?
The IUPAC name of 2-chloro-N-(5-ethyl-1,3,4-oxadiazol-2-yl)propanamide (CID 82109675) is 2-chloro-N-(5-ethyl-1,3,4-oxadiazol-2-yl)propanamide.
What is the SMILES notation for 2-chloro-N-(5-ethyl-1,3,4-oxadiazol-2-yl)propanamide?
The canonical SMILES for 2-chloro-N-(5-ethyl-1,3,4-oxadiazol-2-yl)propanamide is CCc1nnc(NC(=O)C(C)Cl)o1.
What is the InChIKey of 2-chloro-N-(5-ethyl-1,3,4-oxadiazol-2-yl)propanamide?
The InChIKey is BQQKRIHXTCZITL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClN3O2/c1-3-5-10-11-7(13-5)9-6(12)4(2)8/h4H,3H2,1-2H3,(H,9,11,12).
What are the key properties of 2-chloro-N-(5-ethyl-1,3,4-oxadiazol-2-yl)propanamide?
2-chloro-N-(5-ethyl-1,3,4-oxadiazol-2-yl)propanamide has a molecular weight of 203.63 g/mol, XLogP of 1.20, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(5-ethyl-1,3,4-oxadiazol-2-yl)propanamide is sourced from PubChem (CID 82109675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).