C9H13BrN2OS — CID 82110235
3-bromo-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]propanamide (PubChem CID 82110235) has the molecular formula C9H13BrN2OS and a molecular weight of 277.19 g/mol. Its IUPAC name is 3-bromo-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]propanamide.
| Compound Name | 3-bromo-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]propanamide |
|---|---|
| PubChem CID | 82110235 |
| Molecular Formula | C9H13BrN2OS |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | 3-bromo-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]propanamide |
| SMILES | CCc1cnc(CNC(=O)CCBr)s1 |
| InChI | InChI=1S/C9H13BrN2OS/c1-2-7-5-12-9(14-7)6-11-8(13)3-4-10/h5H,2-4,6H2,1H3,(H,11,13) |
| InChIKey | LTKSJYMWTVTPOB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|