About 2-bromo-N-(1H-1,2,4-triazol-5-yl)propanamide
2-bromo-N-(1H-1,2,4-triazol-5-yl)propanamide (PubChem CID 82110523) has the molecular formula C5H7BrN4O
and a molecular weight of 219.04 g/mol. Its IUPAC name is 2-bromo-N-(1H-1,2,4-triazol-5-yl)propanamide.
Molecular Properties
| Compound Name | 2-bromo-N-(1H-1,2,4-triazol-5-yl)propanamide |
| PubChem CID | 82110523 |
| Molecular Formula | C5H7BrN4O |
| Molecular Weight | 219.04 g/mol |
| Exact Mass | 217.98 |
| IUPAC Name | 2-bromo-N-(1H-1,2,4-triazol-5-yl)propanamide |
| SMILES | CC(Br)C(=O)Nc1ncn[nH]1 |
| InChI | InChI=1S/C5H7BrN4O/c1-3(6)4(11)9-5-7-2-8-10-5/h2-3H,1H3,(H2,7,8,9,10,11) |
| InChIKey | SOYGMWMTQLEIHJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.04 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-(1H-1,2,4-triazol-5-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-(1H-1,2,4-triazol-5-yl)propanamide?
The IUPAC name of 2-bromo-N-(1H-1,2,4-triazol-5-yl)propanamide (CID 82110523) is 2-bromo-N-(1H-1,2,4-triazol-5-yl)propanamide.
What is the SMILES notation for 2-bromo-N-(1H-1,2,4-triazol-5-yl)propanamide?
The canonical SMILES for 2-bromo-N-(1H-1,2,4-triazol-5-yl)propanamide is CC(Br)C(=O)Nc1ncn[nH]1.
What is the InChIKey of 2-bromo-N-(1H-1,2,4-triazol-5-yl)propanamide?
The InChIKey is SOYGMWMTQLEIHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7BrN4O/c1-3(6)4(11)9-5-7-2-8-10-5/h2-3H,1H3,(H2,7,8,9,10,11).
What are the key properties of 2-bromo-N-(1H-1,2,4-triazol-5-yl)propanamide?
2-bromo-N-(1H-1,2,4-triazol-5-yl)propanamide has a molecular weight of 219.04 g/mol, XLogP of 0.53, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-(1H-1,2,4-triazol-5-yl)propanamide is sourced from PubChem (CID 82110523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).