About 3,6-diethylquinoline
3,6-diethylquinoline (PubChem CID 82111628) has the molecular formula C13H15N
and a molecular weight of 185.27 g/mol. Its IUPAC name is 3,6-diethylquinoline.
Molecular Properties
| Compound Name | 3,6-diethylquinoline |
| PubChem CID | 82111628 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 3,6-diethylquinoline |
| SMILES | CCc1ccc2ncc(CC)cc2c1 |
| InChI | InChI=1S/C13H15N/c1-3-10-5-6-13-12(7-10)8-11(4-2)9-14-13/h5-9H,3-4H2,1-2H3 |
| InChIKey | RUWIXCOKHQPYBA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,6-diethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-diethylquinoline?
The IUPAC name of 3,6-diethylquinoline (CID 82111628) is 3,6-diethylquinoline.
What is the SMILES notation for 3,6-diethylquinoline?
The canonical SMILES for 3,6-diethylquinoline is CCc1ccc2ncc(CC)cc2c1.
What is the InChIKey of 3,6-diethylquinoline?
The InChIKey is RUWIXCOKHQPYBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N/c1-3-10-5-6-13-12(7-10)8-11(4-2)9-14-13/h5-9H,3-4H2,1-2H3.
What are the key properties of 3,6-diethylquinoline?
3,6-diethylquinoline has a molecular weight of 185.27 g/mol, XLogP of 3.36, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-diethylquinoline is sourced from PubChem (CID 82111628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).