About (2-chlorophenyl) 3-aminopropanoate
(2-chlorophenyl) 3-aminopropanoate (PubChem CID 82112337) has the molecular formula C9H10ClNO2
and a molecular weight of 199.64 g/mol. Its IUPAC name is (2-chlorophenyl) 3-aminopropanoate.
Molecular Properties
| Compound Name | (2-chlorophenyl) 3-aminopropanoate |
| PubChem CID | 82112337 |
| Molecular Formula | C9H10ClNO2 |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | (2-chlorophenyl) 3-aminopropanoate |
| SMILES | NCCC(=O)Oc1ccccc1Cl |
| InChI | InChI=1S/C9H10ClNO2/c10-7-3-1-2-4-8(7)13-9(12)5-6-11/h1-4H,5-6,11H2 |
| InChIKey | QGLYQOXBAOQHPJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-chlorophenyl) 3-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorophenyl) 3-aminopropanoate?
The IUPAC name of (2-chlorophenyl) 3-aminopropanoate (CID 82112337) is (2-chlorophenyl) 3-aminopropanoate.
What is the SMILES notation for (2-chlorophenyl) 3-aminopropanoate?
The canonical SMILES for (2-chlorophenyl) 3-aminopropanoate is NCCC(=O)Oc1ccccc1Cl.
What is the InChIKey of (2-chlorophenyl) 3-aminopropanoate?
The InChIKey is QGLYQOXBAOQHPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClNO2/c10-7-3-1-2-4-8(7)13-9(12)5-6-11/h1-4H,5-6,11H2.
What are the key properties of (2-chlorophenyl) 3-aminopropanoate?
(2-chlorophenyl) 3-aminopropanoate has a molecular weight of 199.64 g/mol, XLogP of 1.59, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorophenyl) 3-aminopropanoate is sourced from PubChem (CID 82112337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).