About 6-ethyl-3-propan-2-yl-5,6,7,8-tetrahydroquinoline
6-ethyl-3-propan-2-yl-5,6,7,8-tetrahydroquinoline (PubChem CID 82112626) has the molecular formula C14H21N
and a molecular weight of 203.33 g/mol. Its IUPAC name is 6-ethyl-3-propan-2-yl-5,6,7,8-tetrahydroquinoline.
Molecular Properties
| Compound Name | 6-ethyl-3-propan-2-yl-5,6,7,8-tetrahydroquinoline |
| PubChem CID | 82112626 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 6-ethyl-3-propan-2-yl-5,6,7,8-tetrahydroquinoline |
| SMILES | CCC1CCc2ncc(C(C)C)cc2C1 |
| InChI | InChI=1S/C14H21N/c1-4-11-5-6-14-12(7-11)8-13(9-15-14)10(2)3/h8-11H,4-7H2,1-3H3 |
| InChIKey | CZZLKNSYIGFACU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-ethyl-3-propan-2-yl-5,6,7,8-tetrahydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-3-propan-2-yl-5,6,7,8-tetrahydroquinoline?
The IUPAC name of 6-ethyl-3-propan-2-yl-5,6,7,8-tetrahydroquinoline (CID 82112626) is 6-ethyl-3-propan-2-yl-5,6,7,8-tetrahydroquinoline.
What is the SMILES notation for 6-ethyl-3-propan-2-yl-5,6,7,8-tetrahydroquinoline?
The canonical SMILES for 6-ethyl-3-propan-2-yl-5,6,7,8-tetrahydroquinoline is CCC1CCc2ncc(C(C)C)cc2C1.
What is the InChIKey of 6-ethyl-3-propan-2-yl-5,6,7,8-tetrahydroquinoline?
The InChIKey is CZZLKNSYIGFACU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N/c1-4-11-5-6-14-12(7-11)8-13(9-15-14)10(2)3/h8-11H,4-7H2,1-3H3.
What are the key properties of 6-ethyl-3-propan-2-yl-5,6,7,8-tetrahydroquinoline?
6-ethyl-3-propan-2-yl-5,6,7,8-tetrahydroquinoline has a molecular weight of 203.33 g/mol, XLogP of 3.72, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-3-propan-2-yl-5,6,7,8-tetrahydroquinoline is sourced from PubChem (CID 82112626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).