C11H17ClN2 — CID 82113445
3-N-(4-chlorophenyl)-3-N-methylbutane-1,3-diamine (PubChem CID 82113445) has the molecular formula C11H17ClN2 and a molecular weight of 212.72 g/mol. Its IUPAC name is 3-N-(4-chlorophenyl)-3-N-methylbutane-1,3-diamine.
| Compound Name | 3-N-(4-chlorophenyl)-3-N-methylbutane-1,3-diamine |
|---|---|
| PubChem CID | 82113445 |
| Molecular Formula | C11H17ClN2 |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 3-N-(4-chlorophenyl)-3-N-methylbutane-1,3-diamine |
| SMILES | CC(CCN)N(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H17ClN2/c1-9(7-8-13)14(2)11-5-3-10(12)4-6-11/h3-6,9H,7-8,13H2,1-2H3 |
| InChIKey | JVBZMCGOYITKRL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |