C10H10ClFO2 — CID 82113848
2-(2-chloro-6-fluorophenyl)-1,3-dioxane (PubChem CID 82113848) has the molecular formula C10H10ClFO2 and a molecular weight of 216.64 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1,3-dioxane.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1,3-dioxane |
|---|---|
| PubChem CID | 82113848 |
| Molecular Formula | C10H10ClFO2 |
| Molecular Weight | 216.64 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1,3-dioxane |
| SMILES | Fc1cccc(Cl)c1C1OCCCO1 |
| InChI | InChI=1S/C10H10ClFO2/c11-7-3-1-4-8(12)9(7)10-13-5-2-6-14-10/h1,3-4,10H,2,5-6H2 |
| InChIKey | FWNMKDNASJHDGB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.64 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |