C12H14N2O2 — CID 82114028
1,3-dimethyl-5-(3-methylphenyl)imidazolidine-2,4-dione (PubChem CID 82114028) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 1,3-dimethyl-5-(3-methylphenyl)imidazolidine-2,4-dione.
| Compound Name | 1,3-dimethyl-5-(3-methylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 82114028 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1,3-dimethyl-5-(3-methylphenyl)imidazolidine-2,4-dione |
| SMILES | Cc1cccc(C2C(=O)N(C)C(=O)N2C)c1 |
| InChI | InChI=1S/C12H14N2O2/c1-8-5-4-6-9(7-8)10-11(15)14(3)12(16)13(10)2/h4-7,10H,1-3H3 |
| InChIKey | MDKOAKXHCHXWLY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|