About 2-(4-prop-2-enyl-2,3-dihydro-1,4-benzoxazin-2-yl)ethanamine
2-(4-prop-2-enyl-2,3-dihydro-1,4-benzoxazin-2-yl)ethanamine (PubChem CID 82114095) has the molecular formula C13H18N2O
and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-(4-prop-2-enyl-2,3-dihydro-1,4-benzoxazin-2-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(4-prop-2-enyl-2,3-dihydro-1,4-benzoxazin-2-yl)ethanamine |
| PubChem CID | 82114095 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 2-(4-prop-2-enyl-2,3-dihydro-1,4-benzoxazin-2-yl)ethanamine |
| SMILES | C=CCN1CC(CCN)Oc2ccccc21 |
| InChI | InChI=1S/C13H18N2O/c1-2-9-15-10-11(7-8-14)16-13-6-4-3-5-12(13)15/h2-6,11H,1,7-10,14H2 |
| InChIKey | GPEQZLKUPAIGTP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-prop-2-enyl-2,3-dihydro-1,4-benzoxazin-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-prop-2-enyl-2,3-dihydro-1,4-benzoxazin-2-yl)ethanamine?
The IUPAC name of 2-(4-prop-2-enyl-2,3-dihydro-1,4-benzoxazin-2-yl)ethanamine (CID 82114095) is 2-(4-prop-2-enyl-2,3-dihydro-1,4-benzoxazin-2-yl)ethanamine.
What is the SMILES notation for 2-(4-prop-2-enyl-2,3-dihydro-1,4-benzoxazin-2-yl)ethanamine?
The canonical SMILES for 2-(4-prop-2-enyl-2,3-dihydro-1,4-benzoxazin-2-yl)ethanamine is C=CCN1CC(CCN)Oc2ccccc21.
What is the InChIKey of 2-(4-prop-2-enyl-2,3-dihydro-1,4-benzoxazin-2-yl)ethanamine?
The InChIKey is GPEQZLKUPAIGTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O/c1-2-9-15-10-11(7-8-14)16-13-6-4-3-5-12(13)15/h2-6,11H,1,7-10,14H2.
What are the key properties of 2-(4-prop-2-enyl-2,3-dihydro-1,4-benzoxazin-2-yl)ethanamine?
2-(4-prop-2-enyl-2,3-dihydro-1,4-benzoxazin-2-yl)ethanamine has a molecular weight of 218.30 g/mol, XLogP of 1.79, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-prop-2-enyl-2,3-dihydro-1,4-benzoxazin-2-yl)ethanamine is sourced from PubChem (CID 82114095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).