C15H12N2 — CID 82114384
6-(2,3-dihydro-1H-inden-5-yl)pyridine-3-carbonitrile (PubChem CID 82114384) has the molecular formula C15H12N2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 6-(2,3-dihydro-1H-inden-5-yl)pyridine-3-carbonitrile.
| Compound Name | 6-(2,3-dihydro-1H-inden-5-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 82114384 |
| Molecular Formula | C15H12N2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 6-(2,3-dihydro-1H-inden-5-yl)pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(-c2ccc3c(c2)CCC3)nc1 |
| InChI | InChI=1S/C15H12N2/c16-9-11-4-7-15(17-10-11)14-6-5-12-2-1-3-13(12)8-14/h4-8,10H,1-3H2 |
| InChIKey | XCLDTJFXTWUKGB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |