About 1-cyclopropyl-1-(3,4-difluorophenyl)-2-(methylamino)ethanol
1-cyclopropyl-1-(3,4-difluorophenyl)-2-(methylamino)ethanol (PubChem CID 82115239) has the molecular formula C12H15F2NO
and a molecular weight of 227.25 g/mol. Its IUPAC name is 1-cyclopropyl-1-(3,4-difluorophenyl)-2-(methylamino)ethanol.
Molecular Properties
| Compound Name | 1-cyclopropyl-1-(3,4-difluorophenyl)-2-(methylamino)ethanol |
| PubChem CID | 82115239 |
| Molecular Formula | C12H15F2NO |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 1-cyclopropyl-1-(3,4-difluorophenyl)-2-(methylamino)ethanol |
| SMILES | CNCC(O)(c1ccc(F)c(F)c1)C1CC1 |
| InChI | InChI=1S/C12H15F2NO/c1-15-7-12(16,8-2-3-8)9-4-5-10(13)11(14)6-9/h4-6,8,15-16H,2-3,7H2,1H3 |
| InChIKey | PAWFAIWBEWQIDO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopropyl-1-(3,4-difluorophenyl)-2-(methylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-1-(3,4-difluorophenyl)-2-(methylamino)ethanol?
The IUPAC name of 1-cyclopropyl-1-(3,4-difluorophenyl)-2-(methylamino)ethanol (CID 82115239) is 1-cyclopropyl-1-(3,4-difluorophenyl)-2-(methylamino)ethanol.
What is the SMILES notation for 1-cyclopropyl-1-(3,4-difluorophenyl)-2-(methylamino)ethanol?
The canonical SMILES for 1-cyclopropyl-1-(3,4-difluorophenyl)-2-(methylamino)ethanol is CNCC(O)(c1ccc(F)c(F)c1)C1CC1.
What is the InChIKey of 1-cyclopropyl-1-(3,4-difluorophenyl)-2-(methylamino)ethanol?
The InChIKey is PAWFAIWBEWQIDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F2NO/c1-15-7-12(16,8-2-3-8)9-4-5-10(13)11(14)6-9/h4-6,8,15-16H,2-3,7H2,1H3.
What are the key properties of 1-cyclopropyl-1-(3,4-difluorophenyl)-2-(methylamino)ethanol?
1-cyclopropyl-1-(3,4-difluorophenyl)-2-(methylamino)ethanol has a molecular weight of 227.25 g/mol, XLogP of 1.78, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-1-(3,4-difluorophenyl)-2-(methylamino)ethanol is sourced from PubChem (CID 82115239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).