methyl 4-oxo-1H-quinoline-2-carboxylate

C11H9NO3 — CID 821167

IUPACmethyl 4-oxo-1H-quinoline-2-carboxylate
SMILESCOC(=O)c1cc(=O)c2ccccc2[nH]1
InChIInChI=1S/C11H9NO3/c1-15-11(14)9-6-10(13)7-4-2-3-5-8(7)12-9/h2-6H,1H3,(H,12,13)
InChIKeyRMPKIWQIHSVNCB-UHFFFAOYSA-N
MW203.20 g/mol
LogP1.31
Rot. Bonds1

About methyl 4-oxo-1H-quinoline-2-carboxylate

methyl 4-oxo-1H-quinoline-2-carboxylate (PubChem CID 821167) has the molecular formula C11H9NO3 and a molecular weight of 203.20 g/mol. Its IUPAC name is methyl 4-oxo-1H-quinoline-2-carboxylate.

Molecular Properties

Compound Namemethyl 4-oxo-1H-quinoline-2-carboxylate
PubChem CID821167
Molecular FormulaC11H9NO3
Molecular Weight203.20 g/mol
Exact Mass203.06
IUPAC Namemethyl 4-oxo-1H-quinoline-2-carboxylate
SMILESCOC(=O)c1cc(=O)c2ccccc2[nH]1
InChIInChI=1S/C11H9NO3/c1-15-11(14)9-6-10(13)7-4-2-3-5-8(7)12-9/h2-6H,1H3,(H,12,13)
InChIKeyRMPKIWQIHSVNCB-UHFFFAOYSA-N
XLogP1.31
TPSA59.16 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.20
LogP ≤ 51.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 4-oxo-1H-quinoline-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-oxo-1H-quinoline-2-carboxylate?
The IUPAC name of methyl 4-oxo-1H-quinoline-2-carboxylate (CID 821167) is methyl 4-oxo-1H-quinoline-2-carboxylate.
What is the SMILES notation for methyl 4-oxo-1H-quinoline-2-carboxylate?
The canonical SMILES for methyl 4-oxo-1H-quinoline-2-carboxylate is COC(=O)c1cc(=O)c2ccccc2[nH]1.
What is the InChIKey of methyl 4-oxo-1H-quinoline-2-carboxylate?
The InChIKey is RMPKIWQIHSVNCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO3/c1-15-11(14)9-6-10(13)7-4-2-3-5-8(7)12-9/h2-6H,1H3,(H,12,13).
What are the key properties of methyl 4-oxo-1H-quinoline-2-carboxylate?
methyl 4-oxo-1H-quinoline-2-carboxylate has a molecular weight of 203.20 g/mol, XLogP of 1.31, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-oxo-1H-quinoline-2-carboxylate is sourced from PubChem (CID 821167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).