4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methylbutanoic acid

C13H16O4 — CID 82116705

IUPAC4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methylbutanoic acid
SMILESCC(CC(=O)O)Cc1ccc2c(c1)OCCO2
InChIInChI=1S/C13H16O4/c1-9(7-13(14)15)6-10-2-3-11-12(8-10)17-5-4-16-11/h2-3,8-9H,4-7H2,1H3,(H,14,15)
InChIKeyLCIPKNGTESTULZ-UHFFFAOYSA-N
MW236.27 g/mol
LogP2.11
Rot. Bonds4

About 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methylbutanoic acid

4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methylbutanoic acid (PubChem CID 82116705) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methylbutanoic acid.

Molecular Properties

Compound Name4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methylbutanoic acid
PubChem CID82116705
Molecular FormulaC13H16O4
Molecular Weight236.27 g/mol
Exact Mass236.10
IUPAC Name4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methylbutanoic acid
SMILESCC(CC(=O)O)Cc1ccc2c(c1)OCCO2
InChIInChI=1S/C13H16O4/c1-9(7-13(14)15)6-10-2-3-11-12(8-10)17-5-4-16-11/h2-3,8-9H,4-7H2,1H3,(H,14,15)
InChIKeyLCIPKNGTESTULZ-UHFFFAOYSA-N
XLogP2.11
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.27
LogP ≤ 52.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methylbutanoic acid?
The IUPAC name of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methylbutanoic acid (CID 82116705) is 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methylbutanoic acid.
What is the SMILES notation for 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methylbutanoic acid?
The canonical SMILES for 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methylbutanoic acid is CC(CC(=O)O)Cc1ccc2c(c1)OCCO2.
What is the InChIKey of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methylbutanoic acid?
The InChIKey is LCIPKNGTESTULZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O4/c1-9(7-13(14)15)6-10-2-3-11-12(8-10)17-5-4-16-11/h2-3,8-9H,4-7H2,1H3,(H,14,15).
What are the key properties of 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methylbutanoic acid?
4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methylbutanoic acid has a molecular weight of 236.27 g/mol, XLogP of 2.11, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-methylbutanoic acid is sourced from PubChem (CID 82116705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).