C14H20ClN — CID 82116989
2-chloro-5,7-dimethyl-3-propan-2-yl-5,6,7,8-tetrahydroquinoline (PubChem CID 82116989) has the molecular formula C14H20ClN and a molecular weight of 237.77 g/mol. Its IUPAC name is 2-chloro-5,7-dimethyl-3-propan-2-yl-5,6,7,8-tetrahydroquinoline.
| Compound Name | 2-chloro-5,7-dimethyl-3-propan-2-yl-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 82116989 |
| Molecular Formula | C14H20ClN |
| Molecular Weight | 237.77 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 2-chloro-5,7-dimethyl-3-propan-2-yl-5,6,7,8-tetrahydroquinoline |
| SMILES | CC1Cc2nc(Cl)c(C(C)C)cc2C(C)C1 |
| InChI | InChI=1S/C14H20ClN/c1-8(2)11-7-12-10(4)5-9(3)6-13(12)16-14(11)15/h7-10H,5-6H2,1-4H3 |
| InChIKey | YYHBAWZNPCNGKS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.77 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|