C15H19N3 — CID 82117589
2-methyl-5-(1-methyl-4,5,6,7-tetrahydrobenzimidazol-2-yl)aniline (PubChem CID 82117589) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is 2-methyl-5-(1-methyl-4,5,6,7-tetrahydrobenzimidazol-2-yl)aniline.
| Compound Name | 2-methyl-5-(1-methyl-4,5,6,7-tetrahydrobenzimidazol-2-yl)aniline |
|---|---|
| PubChem CID | 82117589 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 2-methyl-5-(1-methyl-4,5,6,7-tetrahydrobenzimidazol-2-yl)aniline |
| SMILES | Cc1ccc(-c2nc3c(n2C)CCCC3)cc1N |
| InChI | InChI=1S/C15H19N3/c1-10-7-8-11(9-12(10)16)15-17-13-5-3-4-6-14(13)18(15)2/h7-9H,3-6,16H2,1-2H3 |
| InChIKey | ANAOINQFDRPEFA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|