C15H14ClF — CID 82119039
1-[5-(chloromethyl)-2-fluorophenyl]-2,4-dimethylbenzene (PubChem CID 82119039) has the molecular formula C15H14ClF and a molecular weight of 248.73 g/mol. Its IUPAC name is 1-[5-(chloromethyl)-2-fluorophenyl]-2,4-dimethylbenzene.
| Compound Name | 1-[5-(chloromethyl)-2-fluorophenyl]-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 82119039 |
| Molecular Formula | C15H14ClF |
| Molecular Weight | 248.73 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 1-[5-(chloromethyl)-2-fluorophenyl]-2,4-dimethylbenzene |
| SMILES | Cc1ccc(-c2cc(CCl)ccc2F)c(C)c1 |
| InChI | InChI=1S/C15H14ClF/c1-10-3-5-13(11(2)7-10)14-8-12(9-16)4-6-15(14)17/h3-8H,9H2,1-2H3 |
| InChIKey | LHZQFFLYCZNDBZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.73 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|