C12H10ClNOS — CID 82119574
5-(3-chloro-4-methylphenyl)furan-2-carbothioamide (PubChem CID 82119574) has the molecular formula C12H10ClNOS and a molecular weight of 251.74 g/mol. Its IUPAC name is 5-(3-chloro-4-methylphenyl)furan-2-carbothioamide.
| Compound Name | 5-(3-chloro-4-methylphenyl)furan-2-carbothioamide |
|---|---|
| PubChem CID | 82119574 |
| Molecular Formula | C12H10ClNOS |
| Molecular Weight | 251.74 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | 5-(3-chloro-4-methylphenyl)furan-2-carbothioamide |
| SMILES | Cc1ccc(-c2ccc(C(N)=S)o2)cc1Cl |
| InChI | InChI=1S/C12H10ClNOS/c1-7-2-3-8(6-9(7)13)10-4-5-11(15-10)12(14)16/h2-6H,1H3,(H2,14,16) |
| InChIKey | YVKLQIBYUJALNP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.74 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|