C15H22ClN — CID 82119587
6-tert-butyl-2-chloro-3-ethyl-5,6,7,8-tetrahydroquinoline (PubChem CID 82119587) has the molecular formula C15H22ClN and a molecular weight of 251.80 g/mol. Its IUPAC name is 6-tert-butyl-2-chloro-3-ethyl-5,6,7,8-tetrahydroquinoline.
| Compound Name | 6-tert-butyl-2-chloro-3-ethyl-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 82119587 |
| Molecular Formula | C15H22ClN |
| Molecular Weight | 251.80 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 6-tert-butyl-2-chloro-3-ethyl-5,6,7,8-tetrahydroquinoline |
| SMILES | CCc1cc2c(nc1Cl)CCC(C(C)(C)C)C2 |
| InChI | InChI=1S/C15H22ClN/c1-5-10-8-11-9-12(15(2,3)4)6-7-13(11)17-14(10)16/h8,12H,5-7,9H2,1-4H3 |
| InChIKey | BTRUSMJAYYJXLN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.80 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|