3-[3-(3,4-difluorophenyl)-1H-pyrazol-5-yl]propanoic acid

C12H10F2N2O2 — CID 82119595

IUPAC3-[3-(3,4-difluorophenyl)-1H-pyrazol-5-yl]propanoic acid
SMILESO=C(O)CCc1cc(-c2ccc(F)c(F)c2)n[nH]1
InChIInChI=1S/C12H10F2N2O2/c13-9-3-1-7(5-10(9)14)11-6-8(15-16-11)2-4-12(17)18/h1,3,5-6H,2,4H2,(H,15,16)(H,17,18)
InChIKeyMXWGMCRNDRJGHB-UHFFFAOYSA-N
MW252.22 g/mol
LogP2.37
Rot. Bonds4

About 3-[3-(3,4-difluorophenyl)-1H-pyrazol-5-yl]propanoic acid

3-[3-(3,4-difluorophenyl)-1H-pyrazol-5-yl]propanoic acid (PubChem CID 82119595) has the molecular formula C12H10F2N2O2 and a molecular weight of 252.22 g/mol. Its IUPAC name is 3-[3-(3,4-difluorophenyl)-1H-pyrazol-5-yl]propanoic acid.

Molecular Properties

Compound Name3-[3-(3,4-difluorophenyl)-1H-pyrazol-5-yl]propanoic acid
PubChem CID82119595
Molecular FormulaC12H10F2N2O2
Molecular Weight252.22 g/mol
Exact Mass252.07
IUPAC Name3-[3-(3,4-difluorophenyl)-1H-pyrazol-5-yl]propanoic acid
SMILESO=C(O)CCc1cc(-c2ccc(F)c(F)c2)n[nH]1
InChIInChI=1S/C12H10F2N2O2/c13-9-3-1-7(5-10(9)14)11-6-8(15-16-11)2-4-12(17)18/h1,3,5-6H,2,4H2,(H,15,16)(H,17,18)
InChIKeyMXWGMCRNDRJGHB-UHFFFAOYSA-N
XLogP2.37
TPSA65.98 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.22
LogP ≤ 52.37
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-[3-(3,4-difluorophenyl)-1H-pyrazol-5-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[3-(3,4-difluorophenyl)-1H-pyrazol-5-yl]propanoic acid?
The IUPAC name of 3-[3-(3,4-difluorophenyl)-1H-pyrazol-5-yl]propanoic acid (CID 82119595) is 3-[3-(3,4-difluorophenyl)-1H-pyrazol-5-yl]propanoic acid.
What is the SMILES notation for 3-[3-(3,4-difluorophenyl)-1H-pyrazol-5-yl]propanoic acid?
The canonical SMILES for 3-[3-(3,4-difluorophenyl)-1H-pyrazol-5-yl]propanoic acid is O=C(O)CCc1cc(-c2ccc(F)c(F)c2)n[nH]1.
What is the InChIKey of 3-[3-(3,4-difluorophenyl)-1H-pyrazol-5-yl]propanoic acid?
The InChIKey is MXWGMCRNDRJGHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F2N2O2/c13-9-3-1-7(5-10(9)14)11-6-8(15-16-11)2-4-12(17)18/h1,3,5-6H,2,4H2,(H,15,16)(H,17,18).
What are the key properties of 3-[3-(3,4-difluorophenyl)-1H-pyrazol-5-yl]propanoic acid?
3-[3-(3,4-difluorophenyl)-1H-pyrazol-5-yl]propanoic acid has a molecular weight of 252.22 g/mol, XLogP of 2.37, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(3,4-difluorophenyl)-1H-pyrazol-5-yl]propanoic acid is sourced from PubChem (CID 82119595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).