About (2-tert-butylphenyl) piperidine-4-carboxylate
(2-tert-butylphenyl) piperidine-4-carboxylate (PubChem CID 82121784) has the molecular formula C16H23NO2
and a molecular weight of 261.37 g/mol. Its IUPAC name is (2-tert-butylphenyl) piperidine-4-carboxylate.
Molecular Properties
| Compound Name | (2-tert-butylphenyl) piperidine-4-carboxylate |
| PubChem CID | 82121784 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (2-tert-butylphenyl) piperidine-4-carboxylate |
| SMILES | CC(C)(C)c1ccccc1OC(=O)C1CCNCC1 |
| InChI | InChI=1S/C16H23NO2/c1-16(2,3)13-6-4-5-7-14(13)19-15(18)12-8-10-17-11-9-12/h4-7,12,17H,8-11H2,1-3H3 |
| InChIKey | QNMYWBSZWMZKJI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-tert-butylphenyl) piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tert-butylphenyl) piperidine-4-carboxylate?
The IUPAC name of (2-tert-butylphenyl) piperidine-4-carboxylate (CID 82121784) is (2-tert-butylphenyl) piperidine-4-carboxylate.
What is the SMILES notation for (2-tert-butylphenyl) piperidine-4-carboxylate?
The canonical SMILES for (2-tert-butylphenyl) piperidine-4-carboxylate is CC(C)(C)c1ccccc1OC(=O)C1CCNCC1.
What is the InChIKey of (2-tert-butylphenyl) piperidine-4-carboxylate?
The InChIKey is QNMYWBSZWMZKJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO2/c1-16(2,3)13-6-4-5-7-14(13)19-15(18)12-8-10-17-11-9-12/h4-7,12,17H,8-11H2,1-3H3.
What are the key properties of (2-tert-butylphenyl) piperidine-4-carboxylate?
(2-tert-butylphenyl) piperidine-4-carboxylate has a molecular weight of 261.37 g/mol, XLogP of 2.89, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tert-butylphenyl) piperidine-4-carboxylate is sourced from PubChem (CID 82121784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).