C8H8BrNO2S — CID 82121850
2-(5-bromothiophen-2-yl)-N,N-dimethyl-2-oxoacetamide (PubChem CID 82121850) has the molecular formula C8H8BrNO2S and a molecular weight of 262.13 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-N,N-dimethyl-2-oxoacetamide.
| Compound Name | 2-(5-bromothiophen-2-yl)-N,N-dimethyl-2-oxoacetamide |
|---|---|
| PubChem CID | 82121850 |
| Molecular Formula | C8H8BrNO2S |
| Molecular Weight | 262.13 g/mol |
| Exact Mass | 260.95 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-N,N-dimethyl-2-oxoacetamide |
| SMILES | CN(C)C(=O)C(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C8H8BrNO2S/c1-10(2)8(12)7(11)5-3-4-6(9)13-5/h3-4H,1-2H3 |
| InChIKey | APOBGRPJLLHJJH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.13 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|