About 4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)benzonitrile
4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)benzonitrile (PubChem CID 82123165) has the molecular formula C17H15NS
and a molecular weight of 265.38 g/mol. Its IUPAC name is 4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)benzonitrile.
Molecular Properties
| Compound Name | 4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)benzonitrile |
| PubChem CID | 82123165 |
| Molecular Formula | C17H15NS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)benzonitrile |
| SMILES | N#Cc1ccc(Sc2ccc3c(c2)CCCC3)cc1 |
| InChI | InChI=1S/C17H15NS/c18-12-13-5-8-16(9-6-13)19-17-10-7-14-3-1-2-4-15(14)11-17/h5-11H,1-4H2 |
| InChIKey | SWOSIOFZLBMKKV-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)benzonitrile?
The IUPAC name of 4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)benzonitrile (CID 82123165) is 4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)benzonitrile.
What is the SMILES notation for 4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)benzonitrile?
The canonical SMILES for 4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)benzonitrile is N#Cc1ccc(Sc2ccc3c(c2)CCCC3)cc1.
What is the InChIKey of 4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)benzonitrile?
The InChIKey is SWOSIOFZLBMKKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NS/c18-12-13-5-8-16(9-6-13)19-17-10-7-14-3-1-2-4-15(14)11-17/h5-11H,1-4H2.
What are the key properties of 4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)benzonitrile?
4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)benzonitrile has a molecular weight of 265.38 g/mol, XLogP of 4.59, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfanyl)benzonitrile is sourced from PubChem (CID 82123165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).