C13H11BrO3 — CID 82124548
2-[5-(3-bromo-4-methylphenyl)furan-2-yl]acetic acid (PubChem CID 82124548) has the molecular formula C13H11BrO3 and a molecular weight of 295.13 g/mol. Its IUPAC name is 2-[5-(3-bromo-4-methylphenyl)furan-2-yl]acetic acid.
| Compound Name | 2-[5-(3-bromo-4-methylphenyl)furan-2-yl]acetic acid |
|---|---|
| PubChem CID | 82124548 |
| Molecular Formula | C13H11BrO3 |
| Molecular Weight | 295.13 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | 2-[5-(3-bromo-4-methylphenyl)furan-2-yl]acetic acid |
| SMILES | Cc1ccc(-c2ccc(CC(=O)O)o2)cc1Br |
| InChI | InChI=1S/C13H11BrO3/c1-8-2-3-9(6-11(8)14)12-5-4-10(17-12)7-13(15)16/h2-6H,7H2,1H3,(H,15,16) |
| InChIKey | ZEVSMQCJQXZNNC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.13 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |