C12H13NO — CID 82125408
5-(4-ethylphenyl)-4-methyl-1,3-oxazole (PubChem CID 82125408) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 5-(4-ethylphenyl)-4-methyl-1,3-oxazole.
| Compound Name | 5-(4-ethylphenyl)-4-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 82125408 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 5-(4-ethylphenyl)-4-methyl-1,3-oxazole |
| SMILES | CCc1ccc(-c2ocnc2C)cc1 |
| InChI | InChI=1S/C12H13NO/c1-3-10-4-6-11(7-5-10)12-9(2)13-8-14-12/h4-8H,3H2,1-2H3 |
| InChIKey | UZVHZPVYIXIEKQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |